3-methylbutyl nitrate


isoamyl nitrate; isopentyl nitrate; 3-methyl-1-butanol nitrate; 3-methylbutyl nitrate; γ-methylbutyl nitrate
CAS RN:[543-87-3]
Formula:C5H11NO3; 133.15 g/mol
InChiKey:NTHGIYFSMNNHSC-UHFFFAOYSA-N
SMILES:O=[N+]([O-])OCCC(C)C
Molecular structure of 3-methylbutyl nitrate
Density:0.996 g/mL
Molar volume:133.7 mL/mol
Refractive index:1.412
Molecular refractive power:33.27 mL/mol
Boiling point:148 °C
Antoine equation
P(Torr) vs T(°C)
Vapour pressure vs temperature
Log10 partition octanol / water:2.84

Isomers

(S)-2-amino-3-ethoxypropanoic acid
Molecular structure of (S)-2-amino-3-ethoxypropanoic acid
2-amino-3-ethoxypropanoic acid
Molecular structure of 2-amino-3-ethoxypropanoic acid
2-amino-4-methoxybutanoic acid
Molecular structure of 2-amino-4-methoxybutanoic acid
N-Boc-hydroxylamine
Molecular structure of N-Boc-hydroxylamine
ethyl N-methoxy-N-methylcarbamate
Molecular structure of ethyl N-methoxy-N-methylcarbamate
2-hydroxy-2-methylaminomethylpropanoic acid
Molecular structure of 2-hydroxy-2-methylaminomethylpropanoic acid
O-methyl-DL-allothreonine
Molecular structure of O-methyl-DL-allothreonine
3-methylbutyl nitrate
Molecular structure of 3-methylbutyl nitrate
3-methyl-2-nitrobutan-1-ol
Molecular structure of 3-methyl-2-nitrobutan-1-ol
pentyl nitrate
Molecular structure of pentyl nitrate
3-pentyl nitrate
Molecular structure of 3-pentyl nitrate